C9H12N2O3 — CID 178052350
3-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione (PubChem CID 178052350) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178052350 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3-(2,2-dimethylpropanoyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)(C)C(=O)n1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C9H12N2O3/c1-9(2,3)7(13)11-6(12)4-5-10-8(11)14/h4-5H,1-3H3,(H,10,14) |
| InChIKey | ALRYGZHSHBVXGA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |