C28H36N8O2 — CID 178052843
3-[(2R,5S)-4-[7-[(1E,3E)-3-cyano-1-(dimethylamino)penta-1,3-dienyl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carbonyl]oxetane-3-carbonitrile (PubChem CID 178052843) has the molecular formula C28H36N8O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 3-[(2R,5S)-4-[7-[(1E,3E)-3-cyano-1-(dimethylamino)penta-1,3-dienyl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carbonyl]oxetane-3-carbonitrile.
| Compound Name | 3-[(2R,5S)-4-[7-[(1E,3E)-3-cyano-1-(dimethylamino)penta-1,3-dienyl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carbonyl]oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 178052843 |
| Molecular Formula | C28H36N8O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 3-[(2R,5S)-4-[7-[(1E,3E)-3-cyano-1-(dimethylamino)penta-1,3-dienyl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclobutane]-4-yl]-2,5-dimethylpiperazine-1-carbonyl]oxetane-3-carbonitrile |
| SMILES | C/C=C(C#N)\C=C(/N(C)C)N1CC2(CCC2)c2c1ncnc2N1C[C@@H](C)N(C(=O)C2(C#N)COC2)C[C@@H]1C |
| InChI | InChI=1S/C28H36N8O2/c1-6-21(11-29)10-22(33(4)5)36-15-27(8-7-9-27)23-24(31-18-32-25(23)36)34-12-20(3)35(13-19(34)2)26(37)28(14-30)16-38-17-28/h6,10,18-20H,7-9,12-13,15-17H2,1-5H3/b21-6+,22-10+/t19-,20+/m0/s1 |
| InChIKey | PQSCIEPDRWFJEE-JAEAQKSRSA-N |
| XLogP | 2.56 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|