C16H13FN2O4 — CID 178053105
methyl 6-[[(2-fluoro-6-formylbenzoyl)amino]methyl]pyridine-2-carboxylate (PubChem CID 178053105) has the molecular formula C16H13FN2O4 and a molecular weight of 316.29 g/mol. Its IUPAC name is methyl 6-[[(2-fluoro-6-formylbenzoyl)amino]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[(2-fluoro-6-formylbenzoyl)amino]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 178053105 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl 6-[[(2-fluoro-6-formylbenzoyl)amino]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CNC(=O)c2c(F)cccc2C=O)n1 |
| InChI | InChI=1S/C16H13FN2O4/c1-23-16(22)13-7-3-5-11(19-13)8-18-15(21)14-10(9-20)4-2-6-12(14)17/h2-7,9H,8H2,1H3,(H,18,21) |
| InChIKey | YQIXRBMNJRYTOA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|