About 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol
1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol (PubChem CID 178053427) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol.
Analyze 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol?
The IUPAC name of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol (CID 178053427) is 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol.
What is the SMILES notation for 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol?
The canonical SMILES for 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol is CC(O)c1cn2c(n1)CCC2.
What is the InChIKey of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol?
The InChIKey is RTQHNNMJJJDMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6(11)7-5-10-4-2-3-8(10)9-7/h5-6,11H,2-4H2,1H3.
What are the key properties of 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol?
1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol has a molecular weight of 152.20 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)ethanol is sourced from PubChem (CID 178053427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).