C7H11F3N2O2 — CID 178057293
1-(trideuteriomethoxy)-4-(trifluoromethyl)pyrrolidine-2-carboxamide (PubChem CID 178057293) has the molecular formula C7H11F3N2O2 and a molecular weight of 215.19 g/mol. Its IUPAC name is 1-(trideuteriomethoxy)-4-(trifluoromethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(trideuteriomethoxy)-4-(trifluoromethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 178057293 |
| Molecular Formula | C7H11F3N2O2 |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-(trideuteriomethoxy)-4-(trifluoromethyl)pyrrolidine-2-carboxamide |
| SMILES | [2H]C([2H])([2H])ON1CC(C(F)(F)F)CC1C(N)=O |
| InChI | InChI=1S/C7H11F3N2O2/c1-14-12-3-4(7(8,9)10)2-5(12)6(11)13/h4-5H,2-3H2,1H3,(H2,11,13)/i1D3 |
| InChIKey | UZBWBRPPRLGMBQ-FIBGUPNXSA-N |
| XLogP | 0.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |