About 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine
6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine (PubChem CID 178058157) has the molecular formula C8H6F3N3
and a molecular weight of 201.15 g/mol. Its IUPAC name is 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine.
Analyze 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine (CID 178058157) is 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine is Cc1cnc2nc(C(F)(F)F)cn2c1.
What is the InChIKey of 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
The InChIKey is GEPHTSOGRPNUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3N3/c1-5-2-12-7-13-6(8(9,10)11)4-14(7)3-5/h2-4H,1H3.
What are the key properties of 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine has a molecular weight of 201.15 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 178058157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).