C18H26F4N2O — CID 178058169
(3E,5E,7Z)-8-amino-6-(2,2-dimethylpentylimino)-5-ethylidene-3,9,9,9-tetrafluoronona-3,7-dien-2-one (PubChem CID 178058169) has the molecular formula C18H26F4N2O and a molecular weight of 362.41 g/mol. Its IUPAC name is (3E,5E,7Z)-8-amino-6-(2,2-dimethylpentylimino)-5-ethylidene-3,9,9,9-tetrafluoronona-3,7-dien-2-one.
| Compound Name | (3E,5E,7Z)-8-amino-6-(2,2-dimethylpentylimino)-5-ethylidene-3,9,9,9-tetrafluoronona-3,7-dien-2-one |
|---|---|
| PubChem CID | 178058169 |
| Molecular Formula | C18H26F4N2O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (3E,5E,7Z)-8-amino-6-(2,2-dimethylpentylimino)-5-ethylidene-3,9,9,9-tetrafluoronona-3,7-dien-2-one |
| SMILES | C/C=C(\C=C(\F)C(C)=O)C(/C=C(\N)C(F)(F)F)=N\CC(C)(C)CCC |
| InChI | InChI=1S/C18H26F4N2O/c1-6-8-17(4,5)11-24-15(10-16(23)18(20,21)22)13(7-2)9-14(19)12(3)25/h7,9-10H,6,8,11,23H2,1-5H3/b13-7+,14-9+,16-10-,24-15- |
| InChIKey | GRJLVNIVIXEDQK-KHWFVMKRSA-N |
| XLogP | 5.05 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|