C20H29F4NO — CID 178058273
(3E,5E,6E)-8-(4,4-dimethylhexan-2-ylimino)-5-ethylidene-3,9,9,9-tetrafluoro-6-methylnona-3,6-dien-2-one (PubChem CID 178058273) has the molecular formula C20H29F4NO and a molecular weight of 375.45 g/mol. Its IUPAC name is (3E,5E,6E)-8-(4,4-dimethylhexan-2-ylimino)-5-ethylidene-3,9,9,9-tetrafluoro-6-methylnona-3,6-dien-2-one.
| Compound Name | (3E,5E,6E)-8-(4,4-dimethylhexan-2-ylimino)-5-ethylidene-3,9,9,9-tetrafluoro-6-methylnona-3,6-dien-2-one |
|---|---|
| PubChem CID | 178058273 |
| Molecular Formula | C20H29F4NO |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (3E,5E,6E)-8-(4,4-dimethylhexan-2-ylimino)-5-ethylidene-3,9,9,9-tetrafluoro-6-methylnona-3,6-dien-2-one |
| SMILES | C/C=C(\C=C(\F)C(C)=O)C(/C)=C/C(=N/C(C)CC(C)(C)CC)C(F)(F)F |
| InChI | InChI=1S/C20H29F4NO/c1-8-16(11-17(21)15(5)26)13(3)10-18(20(22,23)24)25-14(4)12-19(6,7)9-2/h8,10-11,14H,9,12H2,1-7H3/b13-10+,16-8+,17-11+,25-18- |
| InChIKey | WEHWMTINOQATMK-FDBPLUKBSA-N |
| XLogP | 6.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|