C25H44F3NO — CID 178058534
2,2-dimethylhexane;ethane;(5Z,7E,8E)-7-ethylidene-11,11,11-trifluoro-8-methyl-10-methyliminoundeca-5,8-dien-4-one (PubChem CID 178058534) has the molecular formula C25H44F3NO and a molecular weight of 431.63 g/mol. Its IUPAC name is 2,2-dimethylhexane;ethane;(5Z,7E,8E)-7-ethylidene-11,11,11-trifluoro-8-methyl-10-methyliminoundeca-5,8-dien-4-one.
| Compound Name | 2,2-dimethylhexane;ethane;(5Z,7E,8E)-7-ethylidene-11,11,11-trifluoro-8-methyl-10-methyliminoundeca-5,8-dien-4-one |
|---|---|
| PubChem CID | 178058534 |
| Molecular Formula | C25H44F3NO |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 2,2-dimethylhexane;ethane;(5Z,7E,8E)-7-ethylidene-11,11,11-trifluoro-8-methyl-10-methyliminoundeca-5,8-dien-4-one |
| SMILES | C/C=C(\C=C/C(=O)CCC)C(/C)=C/C(=N\C)C(F)(F)F.CC.CCCCC(C)(C)C |
| InChI | InChI=1S/C15H20F3NO.C8H18.C2H6/c1-5-7-13(20)9-8-12(6-2)11(3)10-14(19-4)15(16,17)18;1-5-6-7-8(2,3)4;1-2/h6,8-10H,5,7H2,1-4H3;5-7H2,1-4H3;1-2H3/b9-8-,11-10+,12-6+,19-14+;; |
| InChIKey | FOUAZHPQLBFSDG-CQPMUTKSSA-N |
| XLogP | 8.69 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|