C18H35NO — CID 177053627
ethane;(E)-3-ethenyl-5-methyliminohex-3-en-2-one;3-methylhexane (PubChem CID 177053627) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is ethane;(E)-3-ethenyl-5-methyliminohex-3-en-2-one;3-methylhexane.
| Compound Name | ethane;(E)-3-ethenyl-5-methyliminohex-3-en-2-one;3-methylhexane |
|---|---|
| PubChem CID | 177053627 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | ethane;(E)-3-ethenyl-5-methyliminohex-3-en-2-one;3-methylhexane |
| SMILES | C=C/C(=C\C(C)=N\C)C(C)=O.CC.CCCC(C)CC |
| InChI | InChI=1S/C9H13NO.C7H16.C2H6/c1-5-9(8(3)11)6-7(2)10-4;1-4-6-7(3)5-2;1-2/h5-6H,1H2,2-4H3;7H,4-6H2,1-3H3;1-2H3/b9-6+,10-7+;; |
| InChIKey | MDYOAEBJWNKSQB-OUFZTKPXSA-N |
| XLogP | 5.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|