C11H15NO — CID 143466739
1-(6-methylcyclohexa-1,3-dien-1-yl)-2-methyliminopropan-1-one (PubChem CID 143466739) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(6-methylcyclohexa-1,3-dien-1-yl)-2-methyliminopropan-1-one.
| Compound Name | 1-(6-methylcyclohexa-1,3-dien-1-yl)-2-methyliminopropan-1-one |
|---|---|
| PubChem CID | 143466739 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-(6-methylcyclohexa-1,3-dien-1-yl)-2-methyliminopropan-1-one |
| SMILES | C/N=C(\C)C(=O)C1=CC=CCC1C |
| InChI | InChI=1S/C11H15NO/c1-8-6-4-5-7-10(8)11(13)9(2)12-3/h4-5,7-8H,6H2,1-3H3/b12-9+ |
| InChIKey | CTQQJSRTISIPPY-FMIVXFBMSA-N |
| XLogP | 2.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|