C17H23NO — CID 142918166
(3Z,5E,8Z,11E)-5-ethylidene-2-methyl-10-methyliminotrideca-1,3,8,11-tetraen-6-one (PubChem CID 142918166) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (3Z,5E,8Z,11E)-5-ethylidene-2-methyl-10-methyliminotrideca-1,3,8,11-tetraen-6-one.
| Compound Name | (3Z,5E,8Z,11E)-5-ethylidene-2-methyl-10-methyliminotrideca-1,3,8,11-tetraen-6-one |
|---|---|
| PubChem CID | 142918166 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (3Z,5E,8Z,11E)-5-ethylidene-2-methyl-10-methyliminotrideca-1,3,8,11-tetraen-6-one |
| SMILES | C=C(C)/C=C\C(=C/C)C(=O)C/C=C\C(\C=C\C)=N\C |
| InChI | InChI=1S/C17H23NO/c1-6-9-16(18-5)10-8-11-17(19)15(7-2)13-12-14(3)4/h6-10,12-13H,3,11H2,1-2,4-5H3/b9-6+,10-8-,13-12-,15-7+,18-16+ |
| InChIKey | OVONKXFWSRUOOR-CAONUWOTSA-N |
| XLogP | 4.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|