C29H55NO — CID 142121861
2-butyl-4-methylidene-7-(3-propylhexyl)-2,3-dihydroazepine;ethane;pent-1-en-3-one (PubChem CID 142121861) has the molecular formula C29H55NO and a molecular weight of 433.77 g/mol. Its IUPAC name is 2-butyl-4-methylidene-7-(3-propylhexyl)-2,3-dihydroazepine;ethane;pent-1-en-3-one.
| Compound Name | 2-butyl-4-methylidene-7-(3-propylhexyl)-2,3-dihydroazepine;ethane;pent-1-en-3-one |
|---|---|
| PubChem CID | 142121861 |
| Molecular Formula | C29H55NO |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 433.43 |
| IUPAC Name | 2-butyl-4-methylidene-7-(3-propylhexyl)-2,3-dihydroazepine;ethane;pent-1-en-3-one |
| SMILES | C=C1C=CC(CCC(CCC)CCC)=NC(CCCC)C1.C=CC(=O)CC.CC.CC |
| InChI | InChI=1S/C20H35N.C5H8O.2C2H6/c1-5-8-11-20-16-17(4)12-14-19(21-20)15-13-18(9-6-2)10-7-3;1-3-5(6)4-2;2*1-2/h12,14,18,20H,4-11,13,15-16H2,1-3H3;3H,1,4H2,2H3;2*1-2H3 |
| InChIKey | NMBHZEMXYFPLCN-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|