C22H22F2N8O2 — CID 178059052
2-[6-(azetidin-1-ylmethyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile (PubChem CID 178059052) has the molecular formula C22H22F2N8O2 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-[6-(azetidin-1-ylmethyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile.
| Compound Name | 2-[6-(azetidin-1-ylmethyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 178059052 |
| Molecular Formula | C22H22F2N8O2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[6-(azetidin-1-ylmethyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile |
| SMILES | Cc1cncc(-n2c(=O)c(N(N)c3cc(F)c(F)cc3N)c(CN3CCC3)n(CC#N)c2=O)c1 |
| InChI | InChI=1S/C22H22F2N8O2/c1-13-7-14(11-28-10-13)31-21(33)20(32(27)18-9-16(24)15(23)8-17(18)26)19(12-29-4-2-5-29)30(6-3-25)22(31)34/h7-11H,2,4-6,12,26-27H2,1H3 |
| InChIKey | KSPMSRZLAVYFAD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|