C24H18ClF2N7O2 — CID 178059284
2-[6-(3-chlorophenyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile (PubChem CID 178059284) has the molecular formula C24H18ClF2N7O2 and a molecular weight of 509.90 g/mol. Its IUPAC name is 2-[6-(3-chlorophenyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile.
| Compound Name | 2-[6-(3-chlorophenyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 178059284 |
| Molecular Formula | C24H18ClF2N7O2 |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 2-[6-(3-chlorophenyl)-5-(N,2-diamino-4,5-difluoroanilino)-3-(5-methyl-3-pyridinyl)-2,4-dioxopyrimidin-1-yl]acetonitrile |
| SMILES | Cc1cncc(-n2c(=O)c(N(N)c3cc(F)c(F)cc3N)c(-c3cccc(Cl)c3)n(CC#N)c2=O)c1 |
| InChI | InChI=1S/C24H18ClF2N7O2/c1-13-7-16(12-31-11-13)33-23(35)22(34(30)20-10-18(27)17(26)9-19(20)29)21(32(6-5-28)24(33)36)14-3-2-4-15(25)8-14/h2-4,7-12H,6,29-30H2,1H3 |
| InChIKey | SEFHSXNLLWOIQM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|