C28H16Cl2N6O2 — CID 178059054
5-(benzotriazol-1-yl)-6-(3,4-dichlorophenyl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione (PubChem CID 178059054) has the molecular formula C28H16Cl2N6O2 and a molecular weight of 539.38 g/mol. Its IUPAC name is 5-(benzotriazol-1-yl)-6-(3,4-dichlorophenyl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione.
| Compound Name | 5-(benzotriazol-1-yl)-6-(3,4-dichlorophenyl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178059054 |
| Molecular Formula | C28H16Cl2N6O2 |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 5-(benzotriazol-1-yl)-6-(3,4-dichlorophenyl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione |
| SMILES | C#CCn1c(-c2ccc(Cl)c(Cl)c2)c(-n2nnc3ccccc32)c(=O)n(-c2cncc3ccccc23)c1=O |
| InChI | InChI=1S/C28H16Cl2N6O2/c1-2-13-34-25(17-11-12-20(29)21(30)14-17)26(36-23-10-6-5-9-22(23)32-33-36)27(37)35(28(34)38)24-16-31-15-18-7-3-4-8-19(18)24/h1,3-12,14-16H,13H2 |
| InChIKey | BSQZNAJUCUNFEL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|