C22H14F3N3O4 — CID 166085820
2-[[3-isoquinolin-4-yl-2,4-dioxo-6-(trifluoromethyl)quinazolin-1-yl]methyl]prop-2-enoic acid (PubChem CID 166085820) has the molecular formula C22H14F3N3O4 and a molecular weight of 441.37 g/mol. Its IUPAC name is 2-[[3-isoquinolin-4-yl-2,4-dioxo-6-(trifluoromethyl)quinazolin-1-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-isoquinolin-4-yl-2,4-dioxo-6-(trifluoromethyl)quinazolin-1-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166085820 |
| Molecular Formula | C22H14F3N3O4 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[[3-isoquinolin-4-yl-2,4-dioxo-6-(trifluoromethyl)quinazolin-1-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(Cn1c(=O)n(-c2cncc3ccccc23)c(=O)c2cc(C(F)(F)F)ccc21)C(=O)O |
| InChI | InChI=1S/C22H14F3N3O4/c1-12(20(30)31)11-27-17-7-6-14(22(23,24)25)8-16(17)19(29)28(21(27)32)18-10-26-9-13-4-2-3-5-15(13)18/h2-10H,1,11H2,(H,30,31) |
| InChIKey | RDXOZVGQMJDEGH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|