C21H15F3N2O2 — CID 166085788
2-isoquinolin-4-yl-4,4-dimethyl-7-(trifluoromethyl)isoquinoline-1,3-dione (PubChem CID 166085788) has the molecular formula C21H15F3N2O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 2-isoquinolin-4-yl-4,4-dimethyl-7-(trifluoromethyl)isoquinoline-1,3-dione.
| Compound Name | 2-isoquinolin-4-yl-4,4-dimethyl-7-(trifluoromethyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 166085788 |
| Molecular Formula | C21H15F3N2O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-isoquinolin-4-yl-4,4-dimethyl-7-(trifluoromethyl)isoquinoline-1,3-dione |
| SMILES | CC1(C)C(=O)N(c2cncc3ccccc23)C(=O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H15F3N2O2/c1-20(2)16-8-7-13(21(22,23)24)9-15(16)18(27)26(19(20)28)17-11-25-10-12-5-3-4-6-14(12)17/h3-11H,1-2H3 |
| InChIKey | JWBTUSHEZRQZJP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|