C28H18N4O4 — CID 178059028
2-[3-isoquinolin-4-yl-6-(3-methylphenyl)-2,4-dioxo-1H-pyrimidin-5-yl]isoindole-1,3-dione (PubChem CID 178059028) has the molecular formula C28H18N4O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is 2-[3-isoquinolin-4-yl-6-(3-methylphenyl)-2,4-dioxo-1H-pyrimidin-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-isoquinolin-4-yl-6-(3-methylphenyl)-2,4-dioxo-1H-pyrimidin-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 178059028 |
| Molecular Formula | C28H18N4O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-[3-isoquinolin-4-yl-6-(3-methylphenyl)-2,4-dioxo-1H-pyrimidin-5-yl]isoindole-1,3-dione |
| SMILES | Cc1cccc(-c2[nH]c(=O)n(-c3cncc4ccccc34)c(=O)c2N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C28H18N4O4/c1-16-7-6-9-17(13-16)23-24(32-25(33)20-11-4-5-12-21(20)26(32)34)27(35)31(28(36)30-23)22-15-29-14-18-8-2-3-10-19(18)22/h2-15H,1H3,(H,30,36) |
| InChIKey | YCKLNECWLKTUIM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|