C25H19ClN6O2 — CID 178059143
6-(3-chlorophenyl)-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione (PubChem CID 178059143) has the molecular formula C25H19ClN6O2 and a molecular weight of 470.92 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-chlorophenyl)-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178059143 |
| Molecular Formula | C25H19ClN6O2 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 6-(3-chlorophenyl)-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione |
| SMILES | Nc1ccccc1N(N)c1c(-c2cccc(Cl)c2)[nH]c(=O)n(-c2cncc3ccccc23)c1=O |
| InChI | InChI=1S/C25H19ClN6O2/c26-17-8-5-7-15(12-17)22-23(32(28)20-11-4-3-10-19(20)27)24(33)31(25(34)30-22)21-14-29-13-16-6-1-2-9-18(16)21/h1-14H,27-28H2,(H,30,34) |
| InChIKey | KNBKNSLGSPIZTO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|