C21H12ClN3O3 — CID 177214172
6-(2-chlorophenyl)-3-isoquinolin-4-yl-1H-furo[3,2-d]pyrimidine-2,4-dione (PubChem CID 177214172) has the molecular formula C21H12ClN3O3 and a molecular weight of 389.80 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-3-isoquinolin-4-yl-1H-furo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chlorophenyl)-3-isoquinolin-4-yl-1H-furo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177214172 |
| Molecular Formula | C21H12ClN3O3 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 6-(2-chlorophenyl)-3-isoquinolin-4-yl-1H-furo[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2cc(-c3ccccc3Cl)oc2c(=O)n1-c1cncc2ccccc12 |
| InChI | InChI=1S/C21H12ClN3O3/c22-15-8-4-3-7-14(15)18-9-16-19(28-18)20(26)25(21(27)24-16)17-11-23-10-12-5-1-2-6-13(12)17/h1-11H,(H,24,27) |
| InChIKey | NPNKOMKCHAFVQF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |