C18H14F6 — CID 142535810
9-ethyl-9-methyl-3,6-bis(trifluoromethyl)fluorene (PubChem CID 142535810) has the molecular formula C18H14F6 and a molecular weight of 344.30 g/mol. Its IUPAC name is 9-ethyl-9-methyl-3,6-bis(trifluoromethyl)fluorene.
| Compound Name | 9-ethyl-9-methyl-3,6-bis(trifluoromethyl)fluorene |
|---|---|
| PubChem CID | 142535810 |
| Molecular Formula | C18H14F6 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 9-ethyl-9-methyl-3,6-bis(trifluoromethyl)fluorene |
| SMILES | CCC1(C)c2ccc(C(F)(F)F)cc2-c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H14F6/c1-3-16(2)14-6-4-10(17(19,20)21)8-12(14)13-9-11(18(22,23)24)5-7-15(13)16/h4-9H,3H2,1-2H3 |
| InChIKey | YDPJHBTYYMQPPO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |