C21H16F6 — CID 155096008
(4R)-2,2,4-trimethyl-7,12-bis(trifluoromethyl)pentacyclo[7.6.1.01,4.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaene (PubChem CID 155096008) has the molecular formula C21H16F6 and a molecular weight of 382.35 g/mol. Its IUPAC name is (4R)-2,2,4-trimethyl-7,12-bis(trifluoromethyl)pentacyclo[7.6.1.01,4.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaene.
| Compound Name | (4R)-2,2,4-trimethyl-7,12-bis(trifluoromethyl)pentacyclo[7.6.1.01,4.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaene |
|---|---|
| PubChem CID | 155096008 |
| Molecular Formula | C21H16F6 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (4R)-2,2,4-trimethyl-7,12-bis(trifluoromethyl)pentacyclo[7.6.1.01,4.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaene |
| SMILES | CC1(C)C[C@]2(C)c3cc(C(F)(F)F)cc4c3C12c1ccc(C(F)(F)F)cc1-4 |
| InChI | InChI=1S/C21H16F6/c1-17(2)9-18(3)15-8-11(21(25,26)27)7-13-12-6-10(20(22,23)24)4-5-14(12)19(17,18)16(13)15/h4-8H,9H2,1-3H3/t18-,19?/m1/s1 |
| InChIKey | KXJBIADVWNKAKU-MRTLOADZSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |