C12H14F3N — CID 105486439
4,4-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline (PubChem CID 105486439) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is 4,4-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline.
| Compound Name | 4,4-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 105486439 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4,4-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1H-quinoline |
| SMILES | CC1(C)CCNc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H14F3N/c1-11(2)5-6-16-10-4-3-8(7-9(10)11)12(13,14)15/h3-4,7,16H,5-6H2,1-2H3 |
| InChIKey | PSGIOVAIIONUSU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |