C26H20F3NO2 — CID 143214516
(Z,2E)-2-[2-[2-[3-(trifluoromethyl)phenyl]benzo[e]indol-3-yl]ethylidene]pent-3-enoic acid (PubChem CID 143214516) has the molecular formula C26H20F3NO2 and a molecular weight of 435.45 g/mol. Its IUPAC name is (Z,2E)-2-[2-[2-[3-(trifluoromethyl)phenyl]benzo[e]indol-3-yl]ethylidene]pent-3-enoic acid.
| Compound Name | (Z,2E)-2-[2-[2-[3-(trifluoromethyl)phenyl]benzo[e]indol-3-yl]ethylidene]pent-3-enoic acid |
|---|---|
| PubChem CID | 143214516 |
| Molecular Formula | C26H20F3NO2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (Z,2E)-2-[2-[2-[3-(trifluoromethyl)phenyl]benzo[e]indol-3-yl]ethylidene]pent-3-enoic acid |
| SMILES | C/C=C\C(=C/Cn1c(-c2cccc(C(F)(F)F)c2)cc2c3ccccc3ccc21)C(=O)O |
| InChI | InChI=1S/C26H20F3NO2/c1-2-6-18(25(31)32)13-14-30-23-12-11-17-7-3-4-10-21(17)22(23)16-24(30)19-8-5-9-20(15-19)26(27,28)29/h2-13,15-16H,14H2,1H3,(H,31,32)/b6-2-,18-13+ |
| InChIKey | PABJQRPPXNJKCK-LBHVJIBQSA-N |
| XLogP | 7.07 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|