C24H25N5 — CID 143214731
3-[(E)-3-methyl-4-[(2-methylhydrazinyl)diazenyl]but-2-enyl]-2-phenylbenzo[e]indole (PubChem CID 143214731) has the molecular formula C24H25N5 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[(E)-3-methyl-4-[(2-methylhydrazinyl)diazenyl]but-2-enyl]-2-phenylbenzo[e]indole.
| Compound Name | 3-[(E)-3-methyl-4-[(2-methylhydrazinyl)diazenyl]but-2-enyl]-2-phenylbenzo[e]indole |
|---|---|
| PubChem CID | 143214731 |
| Molecular Formula | C24H25N5 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-[(E)-3-methyl-4-[(2-methylhydrazinyl)diazenyl]but-2-enyl]-2-phenylbenzo[e]indole |
| SMILES | CNN/N=N/C/C(C)=C/Cn1c(-c2ccccc2)cc2c3ccccc3ccc21 |
| InChI | InChI=1S/C24H25N5/c1-18(17-26-28-27-25-2)14-15-29-23-13-12-19-8-6-7-11-21(19)22(23)16-24(29)20-9-4-3-5-10-20/h3-14,16H,15,17H2,1-2H3,(H,25,28)(H,26,27)/b18-14+ |
| InChIKey | HQPZTECDXNGISC-NBVRZTHBSA-N |
| XLogP | 5.50 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|