C24H25NO2 — CID 143214819
2-methyl-4-(2-phenylbenzo[e]indol-3-yl)pentane-1,1-diol (PubChem CID 143214819) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-methyl-4-(2-phenylbenzo[e]indol-3-yl)pentane-1,1-diol.
| Compound Name | 2-methyl-4-(2-phenylbenzo[e]indol-3-yl)pentane-1,1-diol |
|---|---|
| PubChem CID | 143214819 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-methyl-4-(2-phenylbenzo[e]indol-3-yl)pentane-1,1-diol |
| SMILES | CC(CC(C)n1c(-c2ccccc2)cc2c3ccccc3ccc21)C(O)O |
| InChI | InChI=1S/C24H25NO2/c1-16(24(26)27)14-17(2)25-22-13-12-18-8-6-7-11-20(18)21(22)15-23(25)19-9-4-3-5-10-19/h3-13,15-17,24,26-27H,14H2,1-2H3 |
| InChIKey | ITJYLBLHGQBINX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|