C20H17F3N2O4S — CID 141328826
(2S)-N-hydroxy-2-[[2-[3-(trifluoromethyl)phenyl]naphthalen-1-yl]sulfamoyl]propanamide (PubChem CID 141328826) has the molecular formula C20H17F3N2O4S and a molecular weight of 438.43 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[[2-[3-(trifluoromethyl)phenyl]naphthalen-1-yl]sulfamoyl]propanamide.
| Compound Name | (2S)-N-hydroxy-2-[[2-[3-(trifluoromethyl)phenyl]naphthalen-1-yl]sulfamoyl]propanamide |
|---|---|
| PubChem CID | 141328826 |
| Molecular Formula | C20H17F3N2O4S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (2S)-N-hydroxy-2-[[2-[3-(trifluoromethyl)phenyl]naphthalen-1-yl]sulfamoyl]propanamide |
| SMILES | C[C@@H](C(=O)NO)S(=O)(=O)Nc1c(-c2cccc(C(F)(F)F)c2)ccc2ccccc12 |
| InChI | InChI=1S/C20H17F3N2O4S/c1-12(19(26)24-27)30(28,29)25-18-16-8-3-2-5-13(16)9-10-17(18)14-6-4-7-15(11-14)20(21,22)23/h2-12,25,27H,1H3,(H,24,26)/t12-/m0/s1 |
| InChIKey | LZZXKIJCLGERQW-LBPRGKRZSA-N |
| XLogP | 4.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|