About ethane;3-methylbut-3-en-2-imine
ethane;3-methylbut-3-en-2-imine (PubChem CID 178062567) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is ethane;3-methylbut-3-en-2-imine.
Molecular Properties
| Compound Name | ethane;3-methylbut-3-en-2-imine |
| PubChem CID | 178062567 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | ethane;3-methylbut-3-en-2-imine |
| SMILES | CC.CC.[H]/N=C(\C)C(=C)C |
| InChI | InChI=1S/C5H9N.2C2H6/c1-4(2)5(3)6;2*1-2/h6H,1H2,2-3H3;2*1-2H3/b6-5+;; |
| InChIKey | YYPAJAMHMOGPBZ-TXOOBNKBSA-N |
| XLogP | 3.65 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylbut-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylbut-3-en-2-imine?
The IUPAC name of ethane;3-methylbut-3-en-2-imine (CID 178062567) is ethane;3-methylbut-3-en-2-imine.
What is the SMILES notation for ethane;3-methylbut-3-en-2-imine?
The canonical SMILES for ethane;3-methylbut-3-en-2-imine is CC.CC.[H]/N=C(\C)C(=C)C.
What is the InChIKey of ethane;3-methylbut-3-en-2-imine?
The InChIKey is YYPAJAMHMOGPBZ-TXOOBNKBSA-N. The full InChI is InChI=1S/C5H9N.2C2H6/c1-4(2)5(3)6;2*1-2/h6H,1H2,2-3H3;2*1-2H3/b6-5+;;.
What are the key properties of ethane;3-methylbut-3-en-2-imine?
ethane;3-methylbut-3-en-2-imine has a molecular weight of 143.27 g/mol, XLogP of 3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylbut-3-en-2-imine is sourced from PubChem (CID 178062567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).