C18H34N2O2 — CID 178063204
1-(4-ethylpiperazin-1-yl)-9-methylundecane-1,8-dione (PubChem CID 178063204) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-9-methylundecane-1,8-dione.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-9-methylundecane-1,8-dione |
|---|---|
| PubChem CID | 178063204 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-9-methylundecane-1,8-dione |
| SMILES | CCC(C)C(=O)CCCCCCC(=O)N1CCN(CC)CC1 |
| InChI | InChI=1S/C18H34N2O2/c1-4-16(3)17(21)10-8-6-7-9-11-18(22)20-14-12-19(5-2)13-15-20/h16H,4-15H2,1-3H3 |
| InChIKey | NVPDIPIMWIKRBJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|