C21H33F2NO2 — CID 178064265
3-[(5S)-6-[(3-ethoxy-4-fluorophenyl)methoxy]-5-fluorohexyl]azepane (PubChem CID 178064265) has the molecular formula C21H33F2NO2 and a molecular weight of 369.50 g/mol. Its IUPAC name is 3-[(5S)-6-[(3-ethoxy-4-fluorophenyl)methoxy]-5-fluorohexyl]azepane.
| Compound Name | 3-[(5S)-6-[(3-ethoxy-4-fluorophenyl)methoxy]-5-fluorohexyl]azepane |
|---|---|
| PubChem CID | 178064265 |
| Molecular Formula | C21H33F2NO2 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 3-[(5S)-6-[(3-ethoxy-4-fluorophenyl)methoxy]-5-fluorohexyl]azepane |
| SMILES | CCOc1cc(COC[C@@H](F)CCCCC2CCCCNC2)ccc1F |
| InChI | InChI=1S/C21H33F2NO2/c1-2-26-21-13-18(10-11-20(21)23)15-25-16-19(22)9-4-3-7-17-8-5-6-12-24-14-17/h10-11,13,17,19,24H,2-9,12,14-16H2,1H3/t17?,19-/m0/s1 |
| InChIKey | NUQJYVOPIVWHCA-NNBQYGFHSA-N |
| XLogP | 5.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|