C10H16Cl2O2Si — CID 178065232
CID 178065232 (PubChem CID 178065232) has the molecular formula C10H16Cl2O2Si and a molecular weight of 267.23 g/mol.
| Compound Name | CID 178065232 |
|---|---|
| PubChem CID | 178065232 |
| Molecular Formula | C10H16Cl2O2Si |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCC[Si]C(Cl)(Cl)CC |
| InChI | InChI=1S/C10H16Cl2O2Si/c1-4-10(11,12)15-7-5-6-14-9(13)8(2)3/h2,4-7H2,1,3H3 |
| InChIKey | YLADDMRMOOJBTH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|