C31H36ClN6O3Si — CID 178066668
CID 178066668 (PubChem CID 178066668) has the molecular formula C31H36ClN6O3Si and a molecular weight of 604.21 g/mol.
| Compound Name | CID 178066668 |
|---|---|
| PubChem CID | 178066668 |
| Molecular Formula | C31H36ClN6O3Si |
| Molecular Weight | 604.21 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | — |
| SMILES | Cc1nc2c(Oc3ccc4ncc(-c5cnn(CC6(C)CCOC6)c5)nc4c3Cl)cccc2n1COCCC[Si](C)C |
| InChI | InChI=1S/C31H36ClN6O3Si/c1-21-35-30-25(38(21)20-40-12-6-14-42(3)4)7-5-8-27(30)41-26-10-9-23-29(28(26)32)36-24(16-33-23)22-15-34-37(17-22)18-31(2)11-13-39-19-31/h5,7-10,15-17H,6,11-14,18-20H2,1-4H3 |
| InChIKey | VAAMOJRVRVCSKQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 89.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.21 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|