C31H65NO6Si2 — CID 178066815
7-[tert-butyl(dimethyl)silyl]oxy-8-[3-[tert-butyl(dimethyl)silyl]oxypropyl-(1-carboxyheptyl)amino]octanoic acid (PubChem CID 178066815) has the molecular formula C31H65NO6Si2 and a molecular weight of 604.03 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-8-[3-[tert-butyl(dimethyl)silyl]oxypropyl-(1-carboxyheptyl)amino]octanoic acid.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-8-[3-[tert-butyl(dimethyl)silyl]oxypropyl-(1-carboxyheptyl)amino]octanoic acid |
|---|---|
| PubChem CID | 178066815 |
| Molecular Formula | C31H65NO6Si2 |
| Molecular Weight | 604.03 g/mol |
| Exact Mass | 603.44 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-8-[3-[tert-butyl(dimethyl)silyl]oxypropyl-(1-carboxyheptyl)amino]octanoic acid |
| SMILES | CCCCCCC(C(=O)O)N(CCCO[Si](C)(C)C(C)(C)C)CC(CCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H65NO6Si2/c1-12-13-14-17-21-27(29(35)36)32(23-19-24-37-39(8,9)30(2,3)4)25-26(20-16-15-18-22-28(33)34)38-40(10,11)31(5,6)7/h26-27H,12-25H2,1-11H3,(H,33,34)(H,35,36) |
| InChIKey | YLUZLTADYCQLHU-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.03 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|