C16H16N2O — CID 178067988
(1Z)-1-phenyl-2-pyrazol-1-ylhepta-1,6-dien-3-one (PubChem CID 178067988) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (1Z)-1-phenyl-2-pyrazol-1-ylhepta-1,6-dien-3-one.
| Compound Name | (1Z)-1-phenyl-2-pyrazol-1-ylhepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 178067988 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (1Z)-1-phenyl-2-pyrazol-1-ylhepta-1,6-dien-3-one |
| SMILES | C=CCCC(=O)/C(=C/c1ccccc1)n1cccn1 |
| InChI | InChI=1S/C16H16N2O/c1-2-3-10-16(19)15(18-12-7-11-17-18)13-14-8-5-4-6-9-14/h2,4-9,11-13H,1,3,10H2/b15-13- |
| InChIKey | JHVYREPOYIENRO-SQFISAMPSA-N |
| XLogP | 3.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|