C11H18O5 — CID 178068572
(2R,3R,4R)-1-(cyclohexen-1-yl)-2,3,4,5-tetrahydroxypentan-1-one (PubChem CID 178068572) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2R,3R,4R)-1-(cyclohexen-1-yl)-2,3,4,5-tetrahydroxypentan-1-one.
| Compound Name | (2R,3R,4R)-1-(cyclohexen-1-yl)-2,3,4,5-tetrahydroxypentan-1-one |
|---|---|
| PubChem CID | 178068572 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2R,3R,4R)-1-(cyclohexen-1-yl)-2,3,4,5-tetrahydroxypentan-1-one |
| SMILES | O=C(C1=CCCCC1)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H18O5/c12-6-8(13)10(15)11(16)9(14)7-4-2-1-3-5-7/h4,8,10-13,15-16H,1-3,5-6H2/t8-,10-,11+/m1/s1 |
| InChIKey | KAFOKWADILDXOG-IEBDPFPHSA-N |
| XLogP | -0.87 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |