C21H26N2O3 — CID 178069466
benzyl N-[4-[(4S)-2,2-dimethyloxan-4-yl]anilino]carbamate (PubChem CID 178069466) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is benzyl N-[4-[(4S)-2,2-dimethyloxan-4-yl]anilino]carbamate.
| Compound Name | benzyl N-[4-[(4S)-2,2-dimethyloxan-4-yl]anilino]carbamate |
|---|---|
| PubChem CID | 178069466 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | benzyl N-[4-[(4S)-2,2-dimethyloxan-4-yl]anilino]carbamate |
| SMILES | CC1(C)C[C@@H](c2ccc(NNC(=O)OCc3ccccc3)cc2)CCO1 |
| InChI | InChI=1S/C21H26N2O3/c1-21(2)14-18(12-13-26-21)17-8-10-19(11-9-17)22-23-20(24)25-15-16-6-4-3-5-7-16/h3-11,18,22H,12-15H2,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | NDPRYAXJEFELRG-SFHVURJKSA-N |
| XLogP | 4.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|