C21H29NO4 — CID 178071138
methyl 4-ethenyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]benzoate (PubChem CID 178071138) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl 4-ethenyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]benzoate.
| Compound Name | methyl 4-ethenyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]benzoate |
|---|---|
| PubChem CID | 178071138 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | methyl 4-ethenyl-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]benzoate |
| SMILES | C=Cc1ccc(C(=O)OC)c(NC2CCC(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H29NO4/c1-6-14-7-12-17(20(24)25-5)18(13-14)22-16-10-8-15(9-11-16)19(23)26-21(2,3)4/h6-7,12-13,15-16,22H,1,8-11H2,2-5H3 |
| InChIKey | QFJWAVLXFWOXLP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |