About 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate
6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate (PubChem CID 178071833) has the molecular formula C21H38O2S
and a molecular weight of 354.60 g/mol. Its IUPAC name is 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate.
Molecular Properties
| Compound Name | 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
| PubChem CID | 178071833 |
| Molecular Formula | C21H38O2S |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
| SMILES | CC(C)CCCCCOC(=O)CCSC1C=C(C(C)C)CCC1C |
| InChI | InChI=1S/C21H38O2S/c1-16(2)9-7-6-8-13-23-21(22)12-14-24-20-15-19(17(3)4)11-10-18(20)5/h15-18,20H,6-14H2,1-5H3 |
| InChIKey | QADXVRMJLQMYCB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
The IUPAC name of 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate (CID 178071833) is 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate.
What is the SMILES notation for 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
The canonical SMILES for 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate is CC(C)CCCCCOC(=O)CCSC1C=C(C(C)C)CCC1C.
What is the InChIKey of 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
The InChIKey is QADXVRMJLQMYCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O2S/c1-16(2)9-7-6-8-13-23-21(22)12-14-24-20-15-19(17(3)4)11-10-18(20)5/h15-18,20H,6-14H2,1-5H3.
What are the key properties of 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate has a molecular weight of 354.60 g/mol, XLogP of 6.25, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl 3-(6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate is sourced from PubChem (CID 178071833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).