About 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate
10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate (PubChem CID 176571450) has the molecular formula C23H42O3S
and a molecular weight of 398.65 g/mol. Its IUPAC name is 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate.
Molecular Properties
| Compound Name | 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
| PubChem CID | 176571450 |
| Molecular Formula | C23H42O3S |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
| SMILES | CC1=CC(SCCC(=O)OCCCCCCCCCCO)C(C(C)C)CC1 |
| InChI | InChI=1S/C23H42O3S/c1-19(2)21-13-12-20(3)18-22(21)27-17-14-23(25)26-16-11-9-7-5-4-6-8-10-15-24/h18-19,21-22,24H,4-17H2,1-3H3 |
| InChIKey | OVSVDVWYGZIAIV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
The IUPAC name of 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate (CID 176571450) is 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate.
What is the SMILES notation for 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
The canonical SMILES for 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate is CC1=CC(SCCC(=O)OCCCCCCCCCCO)C(C(C)C)CC1.
What is the InChIKey of 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
The InChIKey is OVSVDVWYGZIAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42O3S/c1-19(2)21-13-12-20(3)18-22(21)27-17-14-23(25)26-16-11-9-7-5-4-6-8-10-15-24/h18-19,21-22,24H,4-17H2,1-3H3.
What are the key properties of 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate?
10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate has a molecular weight of 398.65 g/mol, XLogP of 6.15, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxydecyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate is sourced from PubChem (CID 176571450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).