C23H42O3S — CID 178071905
10-hydroxydecyl 3-(1-methyl-4-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate (PubChem CID 178071905) has the molecular formula C23H42O3S and a molecular weight of 398.65 g/mol. Its IUPAC name is 10-hydroxydecyl 3-(1-methyl-4-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate.
| Compound Name | 10-hydroxydecyl 3-(1-methyl-4-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 178071905 |
| Molecular Formula | C23H42O3S |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 10-hydroxydecyl 3-(1-methyl-4-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
| SMILES | CC(C)C1C=CC(C)(SCCC(=O)OCCCCCCCCCCO)CC1 |
| InChI | InChI=1S/C23H42O3S/c1-20(2)21-12-15-23(3,16-13-21)27-19-14-22(25)26-18-11-9-7-5-4-6-8-10-17-24/h12,15,20-21,24H,4-11,13-14,16-19H2,1-3H3 |
| InChIKey | PDCSZDCZULDUOM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|