C14H10F3NO — CID 178072195
N-cyclohexa-2,4-dien-1-ylidene-4-(trifluoromethyl)benzamide (PubChem CID 178072195) has the molecular formula C14H10F3NO and a molecular weight of 265.23 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-ylidene-4-(trifluoromethyl)benzamide.
| Compound Name | N-cyclohexa-2,4-dien-1-ylidene-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 178072195 |
| Molecular Formula | C14H10F3NO |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-ylidene-4-(trifluoromethyl)benzamide |
| SMILES | O=C(/N=C1/C=CC=CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F3NO/c15-14(16,17)11-8-6-10(7-9-11)13(19)18-12-4-2-1-3-5-12/h1-4,6-9H,5H2/b18-12- |
| InChIKey | HVLFZYHSIQVLSE-PDGQHHTCSA-N |
| XLogP | 3.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|