C22H16F4N4O3 — CID 178075301
3-(3-fluorophenyl)-N-[2-(2-formamidoethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide (PubChem CID 178075301) has the molecular formula C22H16F4N4O3 and a molecular weight of 460.39 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[2-(2-formamidoethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide.
| Compound Name | 3-(3-fluorophenyl)-N-[2-(2-formamidoethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 178075301 |
| Molecular Formula | C22H16F4N4O3 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[2-(2-formamidoethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide |
| SMILES | O=CNCCOc1ccc(-c2ncc(C(F)(F)F)[nH]2)cc1NC(=O)C#Cc1cccc(F)c1 |
| InChI | InChI=1S/C22H16F4N4O3/c23-16-3-1-2-14(10-16)4-7-20(32)29-17-11-15(5-6-18(17)33-9-8-27-13-31)21-28-12-19(30-21)22(24,25)26/h1-3,5-6,10-13H,8-9H2,(H,27,31)(H,28,30)(H,29,32) |
| InChIKey | TYFAIEKAUBFLGA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|