C22H17ClF3N3O3 — CID 178075492
3-(3-chlorophenyl)-N-[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide (PubChem CID 178075492) has the molecular formula C22H17ClF3N3O3 and a molecular weight of 463.84 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 178075492 |
| Molecular Formula | C22H17ClF3N3O3 |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide |
| SMILES | COCCOc1ccc(-c2ncc(C(F)(F)F)[nH]2)cc1NC(=O)C#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H17ClF3N3O3/c1-31-9-10-32-18-7-6-15(21-27-13-19(29-21)22(24,25)26)12-17(18)28-20(30)8-5-14-3-2-4-16(23)11-14/h2-4,6-7,11-13H,9-10H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | JVSTWCFZKRLELA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|