C26H25ClF4N4O4S — CID 178075375
3-(3-chloro-4-fluorophenyl)-N-[2-[3-(1,1-dihydroxy-1,4-thiazinan-2-yl)propoxy]-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide (PubChem CID 178075375) has the molecular formula C26H25ClF4N4O4S and a molecular weight of 601.02 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-N-[2-[3-(1,1-dihydroxy-1,4-thiazinan-2-yl)propoxy]-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[3-(1,1-dihydroxy-1,4-thiazinan-2-yl)propoxy]-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 178075375 |
| Molecular Formula | C26H25ClF4N4O4S |
| Molecular Weight | 601.02 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[3-(1,1-dihydroxy-1,4-thiazinan-2-yl)propoxy]-5-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1ccc(F)c(Cl)c1)Nc1cc(-c2ncc(C(F)(F)F)[nH]2)ccc1OCCCC1CNCCS1(O)O |
| InChI | InChI=1S/C26H25ClF4N4O4S/c27-19-12-16(3-6-20(19)28)4-8-24(36)34-21-13-17(25-33-15-23(35-25)26(29,30)31)5-7-22(21)39-10-1-2-18-14-32-9-11-40(18,37)38/h3,5-7,12-13,15,18,32,37-38H,1-2,9-11,14H2,(H,33,35)(H,34,36) |
| InChIKey | WANKVKSSORXNTJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.02 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|