C15H14F3N3O3 — CID 178075470
2-[4-(cyclobutylmethoxy)-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole (PubChem CID 178075470) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-[4-(cyclobutylmethoxy)-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 2-[4-(cyclobutylmethoxy)-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 178075470 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[4-(cyclobutylmethoxy)-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole |
| SMILES | O=[N+]([O-])c1cc(-c2ncc(C(F)(F)F)[nH]2)ccc1OCC1CCC1 |
| InChI | InChI=1S/C15H14F3N3O3/c16-15(17,18)13-7-19-14(20-13)10-4-5-12(11(6-10)21(22)23)24-8-9-2-1-3-9/h4-7,9H,1-3,8H2,(H,19,20) |
| InChIKey | ZYGOUDCDRDLZHD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|