C14H12F5N3O4 — CID 178075227
2-[4-[2-(1,1-difluoroethoxy)ethoxy]-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole (PubChem CID 178075227) has the molecular formula C14H12F5N3O4 and a molecular weight of 381.26 g/mol. Its IUPAC name is 2-[4-[2-(1,1-difluoroethoxy)ethoxy]-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 2-[4-[2-(1,1-difluoroethoxy)ethoxy]-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 178075227 |
| Molecular Formula | C14H12F5N3O4 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-[4-[2-(1,1-difluoroethoxy)ethoxy]-3-nitrophenyl]-5-(trifluoromethyl)-1H-imidazole |
| SMILES | CC(F)(F)OCCOc1ccc(-c2ncc(C(F)(F)F)[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12F5N3O4/c1-13(15,16)26-5-4-25-10-3-2-8(6-9(10)22(23)24)12-20-7-11(21-12)14(17,18)19/h2-3,6-7H,4-5H2,1H3,(H,20,21) |
| InChIKey | AAJNPXFZEXWSLG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|