About 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid
2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid (PubChem CID 178078351) has the molecular formula C6H2F6O4
and a molecular weight of 252.07 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid.
Molecular Properties
| Compound Name | 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid |
| PubChem CID | 178078351 |
| Molecular Formula | C6H2F6O4 |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)OC=C(C(F)(F)F)O1 |
| InChI | InChI=1S/C6H2F6O4/c7-5(8,9)2-1-15-4(16-2,3(13)14)6(10,11)12/h1H,(H,13,14) |
| InChIKey | NUUWHZAYFOJHJN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
The IUPAC name of 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid (CID 178078351) is 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid.
What is the SMILES notation for 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
The canonical SMILES for 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid is O=C(O)C1(C(F)(F)F)OC=C(C(F)(F)F)O1.
What is the InChIKey of 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
The InChIKey is NUUWHZAYFOJHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F6O4/c7-5(8,9)2-1-15-4(16-2,3(13)14)6(10,11)12/h1H,(H,13,14).
What are the key properties of 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid?
2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid has a molecular weight of 252.07 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(trifluoromethyl)-1,3-dioxole-2-carboxylic acid is sourced from PubChem (CID 178078351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).