C30H42F3IN2O — CID 178078360
2-(4-phenylcyclohexyl)-N-(6-piperidin-1-ylhexyl)-4-(trifluoromethoxy)aniline;hydroiodide (PubChem CID 178078360) has the molecular formula C30H42F3IN2O and a molecular weight of 630.58 g/mol. Its IUPAC name is 2-(4-phenylcyclohexyl)-N-(6-piperidin-1-ylhexyl)-4-(trifluoromethoxy)aniline;hydroiodide.
| Compound Name | 2-(4-phenylcyclohexyl)-N-(6-piperidin-1-ylhexyl)-4-(trifluoromethoxy)aniline;hydroiodide |
|---|---|
| PubChem CID | 178078360 |
| Molecular Formula | C30H42F3IN2O |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 2-(4-phenylcyclohexyl)-N-(6-piperidin-1-ylhexyl)-4-(trifluoromethoxy)aniline;hydroiodide |
| SMILES | FC(F)(F)Oc1ccc(NCCCCCCN2CCCCC2)c(C2CCC(c3ccccc3)CC2)c1.I |
| InChI | InChI=1S/C30H41F3N2O.HI/c31-30(32,33)36-27-17-18-29(34-19-7-1-2-8-20-35-21-9-4-10-22-35)28(23-27)26-15-13-25(14-16-26)24-11-5-3-6-12-24;/h3,5-6,11-12,17-18,23,25-26,34H,1-2,4,7-10,13-16,19-22H2;1H |
| InChIKey | WWZZTHMOUQGJOH-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|