C18H23F3N2O2S — CID 21103369
3-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one (PubChem CID 21103369) has the molecular formula C18H23F3N2O2S and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21103369 |
| Molecular Formula | C18H23F3N2O2S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccc(OC(F)(F)F)c2)N1CCCCN1CCCC1 |
| InChI | InChI=1S/C18H23F3N2O2S/c19-18(20,21)25-15-7-5-6-14(12-15)17-23(16(24)13-26-17)11-4-3-10-22-8-1-2-9-22/h5-7,12,17H,1-4,8-11,13H2 |
| InChIKey | LVGZILVNEWDZNH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|